C17H20ClN3O4S — CID 113067274
2-(4-chlorophenoxy)-N-[2-[methylsulfonyl(pyridin-2-ylmethyl)amino]ethyl]acetamide (PubChem CID 113067274) has the molecular formula C17H20ClN3O4S and a molecular weight of 397.88 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-[methylsulfonyl(pyridin-2-ylmethyl)amino]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-[methylsulfonyl(pyridin-2-ylmethyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 113067274 |
| Molecular Formula | C17H20ClN3O4S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-[methylsulfonyl(pyridin-2-ylmethyl)amino]ethyl]acetamide |
| SMILES | CS(=O)(=O)N(CCNC(=O)COc1ccc(Cl)cc1)Cc1ccccn1 |
| InChI | InChI=1S/C17H20ClN3O4S/c1-26(23,24)21(12-15-4-2-3-9-19-15)11-10-20-17(22)13-25-16-7-5-14(18)6-8-16/h2-9H,10-13H2,1H3,(H,20,22) |
| InChIKey | JQCDBCZHFMGWLY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |