C17H18N2O3 — CID 24607642
2-(4-acetylphenoxy)-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 24607642) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-(4-acetylphenoxy)-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | 2-(4-acetylphenoxy)-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 24607642 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-(4-acetylphenoxy)-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | CC(=O)c1ccc(OCC(=O)NCCc2ccccn2)cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-13(20)14-5-7-16(8-6-14)22-12-17(21)19-11-9-15-4-2-3-10-18-15/h2-8,10H,9,11-12H2,1H3,(H,19,21) |
| InChIKey | FMRORFZXJMVEEO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |