C22H18N2O4 — CID 156790060
2-(6-oxobenzo[c]chromen-3-yl)oxy-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 156790060) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-(6-oxobenzo[c]chromen-3-yl)oxy-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | 2-(6-oxobenzo[c]chromen-3-yl)oxy-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 156790060 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-(6-oxobenzo[c]chromen-3-yl)oxy-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | O=C(COc1ccc2c(c1)oc(=O)c1ccccc12)NCCc1ccccn1 |
| InChI | InChI=1S/C22H18N2O4/c25-21(24-12-10-15-5-3-4-11-23-15)14-27-16-8-9-18-17-6-1-2-7-19(17)22(26)28-20(18)13-16/h1-9,11,13H,10,12,14H2,(H,24,25) |
| InChIKey | VEGMKEIDHVYOJD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|