C17H17FN2O2S — CID 51164073
2-(4-acetyl-2-fluorophenyl)sulfanyl-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 51164073) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 51164073 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | CC(=O)c1ccc(SCC(=O)NCCc2ccccn2)c(F)c1 |
| InChI | InChI=1S/C17H17FN2O2S/c1-12(21)13-5-6-16(15(18)10-13)23-11-17(22)20-9-7-14-4-2-3-8-19-14/h2-6,8,10H,7,9,11H2,1H3,(H,20,22) |
| InChIKey | RDJOMHPEMQQQDI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |