C15H28N2O — CID 142112887
ethane;2-methyl-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 142112887) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is ethane;2-methyl-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | ethane;2-methyl-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 142112887 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | ethane;2-methyl-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | CC.CC.CC(C)C(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C11H16N2O.2C2H6/c1-9(2)11(14)13-8-6-10-5-3-4-7-12-10;2*1-2/h3-5,7,9H,6,8H2,1-2H3,(H,13,14);2*1-2H3 |
| InChIKey | RGAMDNYJPABGDC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |