C12H15F3N2O2 — CID 51943721
(2S)-N-(2-pyridin-2-ylethyl)-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 51943721) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is (2S)-N-(2-pyridin-2-ylethyl)-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | (2S)-N-(2-pyridin-2-ylethyl)-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 51943721 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (2S)-N-(2-pyridin-2-ylethyl)-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | C[C@H](OCC(F)(F)F)C(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C12H15F3N2O2/c1-9(19-8-12(13,14)15)11(18)17-7-5-10-4-2-3-6-16-10/h2-4,6,9H,5,7-8H2,1H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | NRGYFLFBPJCBDO-VIFPVBQESA-N |
| XLogP | 1.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |