C12H16F3N3O — CID 115571278
2-(2-pyridin-2-ylethylamino)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 115571278) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-(2-pyridin-2-ylethylamino)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-(2-pyridin-2-ylethylamino)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 115571278 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-(2-pyridin-2-ylethylamino)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(NCCc1ccccn1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O/c1-9(11(19)18-8-12(13,14)15)16-7-5-10-4-2-3-6-17-10/h2-4,6,9,16H,5,7-8H2,1H3,(H,18,19) |
| InChIKey | RVJRYBGGPKVCRY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |