C14H21N3O — CID 43083640
2-(2-pyridin-2-ylethylamino)-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 43083640) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(2-pyridin-2-ylethylamino)-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-(2-pyridin-2-ylethylamino)-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 43083640 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-(2-pyridin-2-ylethylamino)-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CC(NCCc1ccccn1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H21N3O/c1-12(14(18)17-10-4-5-11-17)15-9-7-13-6-2-3-8-16-13/h2-3,6,8,12,15H,4-5,7,9-11H2,1H3 |
| InChIKey | FTZZSJPRGXKIDL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |