C12H18N4O — CID 106832007
2-(pyridazin-3-ylmethylamino)-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 106832007) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(pyridazin-3-ylmethylamino)-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-(pyridazin-3-ylmethylamino)-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 106832007 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-(pyridazin-3-ylmethylamino)-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CC(NCc1cccnn1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H18N4O/c1-10(12(17)16-7-2-3-8-16)13-9-11-5-4-6-14-15-11/h4-6,10,13H,2-3,7-9H2,1H3 |
| InChIKey | HCQOFEAJCQTFOT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |