C12H16N2O — CID 84583378
3-pyridin-2-yl-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 84583378) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-pyridin-2-yl-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-pyridin-2-yl-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 84583378 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-pyridin-2-yl-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | O=C(CCc1ccccn1)N1CCCC1 |
| InChI | InChI=1S/C12H16N2O/c15-12(14-9-3-4-10-14)7-6-11-5-1-2-8-13-11/h1-2,5,8H,3-4,6-7,9-10H2 |
| InChIKey | UJUNVZPLSGUFAL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |