C21H28N4O — CID 129473864
1-[(4S)-4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]-3-pyridin-2-ylpropan-1-one (PubChem CID 129473864) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-[(4S)-4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]-3-pyridin-2-ylpropan-1-one.
| Compound Name | 1-[(4S)-4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]-3-pyridin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 129473864 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1-[(4S)-4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]-3-pyridin-2-ylpropan-1-one |
| SMILES | CN(Cc1ccccn1)[C@H]1CCCN(C(=O)CCc2ccccn2)CC1 |
| InChI | InChI=1S/C21H28N4O/c1-24(17-19-8-3-5-14-23-19)20-9-6-15-25(16-12-20)21(26)11-10-18-7-2-4-13-22-18/h2-5,7-8,13-14,20H,6,9-12,15-17H2,1H3/t20-/m0/s1 |
| InChIKey | ASKRJTZLXMMZON-FQEVSTJZSA-N |
| XLogP | 2.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |