C21H24N4O — CID 129343587
4-[(4S)-4-[methyl(pyridin-2-ylmethyl)amino]azepane-1-carbonyl]benzonitrile (PubChem CID 129343587) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-[(4S)-4-[methyl(pyridin-2-ylmethyl)amino]azepane-1-carbonyl]benzonitrile.
| Compound Name | 4-[(4S)-4-[methyl(pyridin-2-ylmethyl)amino]azepane-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 129343587 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-[(4S)-4-[methyl(pyridin-2-ylmethyl)amino]azepane-1-carbonyl]benzonitrile |
| SMILES | CN(Cc1ccccn1)[C@H]1CCCN(C(=O)c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C21H24N4O/c1-24(16-19-5-2-3-12-23-19)20-6-4-13-25(14-11-20)21(26)18-9-7-17(15-22)8-10-18/h2-3,5,7-10,12,20H,4,6,11,13-14,16H2,1H3/t20-/m0/s1 |
| InChIKey | XAWURWVEFXDUHO-FQEVSTJZSA-N |
| XLogP | 3.08 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |