C21H31N3O — CID 129007494
2-(cyclohexen-1-yl)-1-[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]ethanone (PubChem CID 129007494) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]ethanone |
|---|---|
| PubChem CID | 129007494 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]ethanone |
| SMILES | CN(Cc1ccccn1)C1CCCN(C(=O)CC2=CCCCC2)CC1 |
| InChI | InChI=1S/C21H31N3O/c1-23(17-19-10-5-6-13-22-19)20-11-7-14-24(15-12-20)21(25)16-18-8-3-2-4-9-18/h5-6,8,10,13,20H,2-4,7,9,11-12,14-17H2,1H3 |
| InChIKey | WQSKHYRKBBUTIC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|