C21H30N4O — CID 129002934
1-[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]-4-pyrrol-1-ylbutan-1-one (PubChem CID 129002934) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]-4-pyrrol-1-ylbutan-1-one.
| Compound Name | 1-[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]-4-pyrrol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 129002934 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]-4-pyrrol-1-ylbutan-1-one |
| SMILES | CN(Cc1ccccn1)C1CCCN(C(=O)CCCn2cccc2)CC1 |
| InChI | InChI=1S/C21H30N4O/c1-23(18-19-8-2-3-12-22-19)20-9-6-16-25(17-11-20)21(26)10-7-15-24-13-4-5-14-24/h2-5,8,12-14,20H,6-7,9-11,15-18H2,1H3 |
| InChIKey | GQJAUHSOWXQVAK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |