C13H16N2O — CID 112534839
1-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridin-2-ylpropan-1-one (PubChem CID 112534839) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridin-2-ylpropan-1-one.
| Compound Name | 1-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 112534839 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridin-2-ylpropan-1-one |
| SMILES | O=C(CCc1ccccn1)N1CC2CC2C1 |
| InChI | InChI=1S/C13H16N2O/c16-13(15-8-10-7-11(10)9-15)5-4-12-3-1-2-6-14-12/h1-3,6,10-11H,4-5,7-9H2 |
| InChIKey | WTPFUHHEJSHRER-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |