C16H19ClN2O5S — CID 113066480
2-(4-chlorophenoxy)-N-[2-[furan-2-ylmethyl(methylsulfonyl)amino]ethyl]acetamide (PubChem CID 113066480) has the molecular formula C16H19ClN2O5S and a molecular weight of 386.86 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-[furan-2-ylmethyl(methylsulfonyl)amino]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-[furan-2-ylmethyl(methylsulfonyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 113066480 |
| Molecular Formula | C16H19ClN2O5S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-[furan-2-ylmethyl(methylsulfonyl)amino]ethyl]acetamide |
| SMILES | CS(=O)(=O)N(CCNC(=O)COc1ccc(Cl)cc1)Cc1ccco1 |
| InChI | InChI=1S/C16H19ClN2O5S/c1-25(21,22)19(11-15-3-2-10-23-15)9-8-18-16(20)12-24-14-6-4-13(17)5-7-14/h2-7,10H,8-9,11-12H2,1H3,(H,18,20) |
| InChIKey | MZYOIPFREYDUDX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |