C16H16F3N3O3S — CID 113151534
2-[methylsulfonyl(pyridin-2-ylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 113151534) has the molecular formula C16H16F3N3O3S and a molecular weight of 387.38 g/mol. Its IUPAC name is 2-[methylsulfonyl(pyridin-2-ylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[methylsulfonyl(pyridin-2-ylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 113151534 |
| Molecular Formula | C16H16F3N3O3S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-[methylsulfonyl(pyridin-2-ylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1cccc(C(F)(F)F)c1)Cc1ccccn1 |
| InChI | InChI=1S/C16H16F3N3O3S/c1-26(24,25)22(10-14-6-2-3-8-20-14)11-15(23)21-13-7-4-5-12(9-13)16(17,18)19/h2-9H,10-11H2,1H3,(H,21,23) |
| InChIKey | MSSVLIOJXZQSJI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |