C14H24N4O3S — CID 113138116
3-[2-(dimethylamino)ethyl-methylsulfonylamino]-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 113138116) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl-methylsulfonylamino]-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 3-[2-(dimethylamino)ethyl-methylsulfonylamino]-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 113138116 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl-methylsulfonylamino]-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | CN(C)CCN(CCC(=O)NCc1ccncc1)S(C)(=O)=O |
| InChI | InChI=1S/C14H24N4O3S/c1-17(2)10-11-18(22(3,20)21)9-6-14(19)16-12-13-4-7-15-8-5-13/h4-5,7-8H,6,9-12H2,1-3H3,(H,16,19) |
| InChIKey | SMKMTOSFHPFLTL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |