C16H26N2O2 — CID 115644655
tert-butyl N-[2-[(2-ethylphenyl)methylamino]ethyl]carbamate (PubChem CID 115644655) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-ethylphenyl)methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-ethylphenyl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 115644655 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | tert-butyl N-[2-[(2-ethylphenyl)methylamino]ethyl]carbamate |
| SMILES | CCc1ccccc1CNCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26N2O2/c1-5-13-8-6-7-9-14(13)12-17-10-11-18-15(19)20-16(2,3)4/h6-9,17H,5,10-12H2,1-4H3,(H,18,19) |
| InChIKey | NJCHTTBTQSUFIP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|