C14H22N2O4 — CID 103740181
tert-butyl N-[2-[(2,4-dihydroxyphenyl)methylamino]ethyl]carbamate (PubChem CID 103740181) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,4-dihydroxyphenyl)methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2,4-dihydroxyphenyl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 103740181 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl N-[2-[(2,4-dihydroxyphenyl)methylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNCc1ccc(O)cc1O |
| InChI | InChI=1S/C14H22N2O4/c1-14(2,3)20-13(19)16-7-6-15-9-10-4-5-11(17)8-12(10)18/h4-5,8,15,17-18H,6-7,9H2,1-3H3,(H,16,19) |
| InChIKey | FRISTBBGNFORQI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|