C14H15NO4 — CID 154092442
4-[[(2,4-dihydroxyphenyl)methylamino]methyl]benzene-1,3-diol (PubChem CID 154092442) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-[[(2,4-dihydroxyphenyl)methylamino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[(2,4-dihydroxyphenyl)methylamino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 154092442 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-[[(2,4-dihydroxyphenyl)methylamino]methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CNCc2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C14H15NO4/c16-11-3-1-9(13(18)5-11)7-15-8-10-2-4-12(17)6-14(10)19/h1-6,15-19H,7-8H2 |
| InChIKey | JPQVCWVNERVGEH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|