C7H9NO3 — CID 10261303
4-[(hydroxyamino)methyl]benzene-1,3-diol (PubChem CID 10261303) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 4-[(hydroxyamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(hydroxyamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 10261303 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 4-[(hydroxyamino)methyl]benzene-1,3-diol |
| SMILES | ONCc1ccc(O)cc1O |
| InChI | InChI=1S/C7H9NO3/c9-6-2-1-5(4-8-11)7(10)3-6/h1-3,8-11H,4H2 |
| InChIKey | MVJGVEVPAGILEY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|