C13H10Cl2FNO2 — CID 83077129
4-[(2,6-dichloro-4-fluoroanilino)methyl]benzene-1,3-diol (PubChem CID 83077129) has the molecular formula C13H10Cl2FNO2 and a molecular weight of 302.13 g/mol. Its IUPAC name is 4-[(2,6-dichloro-4-fluoroanilino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(2,6-dichloro-4-fluoroanilino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 83077129 |
| Molecular Formula | C13H10Cl2FNO2 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 4-[(2,6-dichloro-4-fluoroanilino)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CNc2c(Cl)cc(F)cc2Cl)c(O)c1 |
| InChI | InChI=1S/C13H10Cl2FNO2/c14-10-3-8(16)4-11(15)13(10)17-6-7-1-2-9(18)5-12(7)19/h1-5,17-19H,6H2 |
| InChIKey | MRHBADFXXRVBQH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|