C14H12Cl3NO2 — CID 63425254
5-methoxy-2-[(2,4,6-trichloroanilino)methyl]phenol (PubChem CID 63425254) has the molecular formula C14H12Cl3NO2 and a molecular weight of 332.61 g/mol. Its IUPAC name is 5-methoxy-2-[(2,4,6-trichloroanilino)methyl]phenol.
| Compound Name | 5-methoxy-2-[(2,4,6-trichloroanilino)methyl]phenol |
|---|---|
| PubChem CID | 63425254 |
| Molecular Formula | C14H12Cl3NO2 |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 5-methoxy-2-[(2,4,6-trichloroanilino)methyl]phenol |
| SMILES | COc1ccc(CNc2c(Cl)cc(Cl)cc2Cl)c(O)c1 |
| InChI | InChI=1S/C14H12Cl3NO2/c1-20-10-3-2-8(13(19)6-10)7-18-14-11(16)4-9(15)5-12(14)17/h2-6,18-19H,7H2,1H3 |
| InChIKey | UZGXTXZLERYCAE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|