C11H11ClN2O2S — CID 145483652
2-[[(5-chloro-1,3-thiazol-2-yl)amino]methyl]-5-methoxyphenol (PubChem CID 145483652) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 2-[[(5-chloro-1,3-thiazol-2-yl)amino]methyl]-5-methoxyphenol.
| Compound Name | 2-[[(5-chloro-1,3-thiazol-2-yl)amino]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 145483652 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-[[(5-chloro-1,3-thiazol-2-yl)amino]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CNc2ncc(Cl)s2)c(O)c1 |
| InChI | InChI=1S/C11H11ClN2O2S/c1-16-8-3-2-7(9(15)4-8)5-13-11-14-6-10(12)17-11/h2-4,6,15H,5H2,1H3,(H,13,14) |
| InChIKey | HDTPDLMIOPHEGW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|