C13H9Cl3FNO — CID 112607220
2-chloro-6-[(2,6-dichloro-4-fluoroanilino)methyl]phenol (PubChem CID 112607220) has the molecular formula C13H9Cl3FNO and a molecular weight of 320.58 g/mol. Its IUPAC name is 2-chloro-6-[(2,6-dichloro-4-fluoroanilino)methyl]phenol.
| Compound Name | 2-chloro-6-[(2,6-dichloro-4-fluoroanilino)methyl]phenol |
|---|---|
| PubChem CID | 112607220 |
| Molecular Formula | C13H9Cl3FNO |
| Molecular Weight | 320.58 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 2-chloro-6-[(2,6-dichloro-4-fluoroanilino)methyl]phenol |
| SMILES | Oc1c(Cl)cccc1CNc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C13H9Cl3FNO/c14-9-3-1-2-7(13(9)19)6-18-12-10(15)4-8(17)5-11(12)16/h1-5,18-19H,6H2 |
| InChIKey | OTTWFXQYIAELHQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|