C8H10O2 — CID 17927
4-ethylbenzene-1,3-diol (PubChem CID 17927) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-ethylbenzene-1,3-diol.
| Compound Name | 4-ethylbenzene-1,3-diol |
|---|---|
| PubChem CID | 17927 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 4-ethylbenzene-1,3-diol |
| SMILES | CCc1ccc(O)cc1O |
| InChI | InChI=1S/C8H10O2/c1-2-6-3-4-7(9)5-8(6)10/h3-5,9-10H,2H2,1H3 |
| InChIKey | VGMJYYDKPUPTID-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |