C10H16O3 — CID 70585876
4-ethylbenzene-1,3-diol;methoxymethane (PubChem CID 70585876) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 4-ethylbenzene-1,3-diol;methoxymethane.
| Compound Name | 4-ethylbenzene-1,3-diol;methoxymethane |
|---|---|
| PubChem CID | 70585876 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 4-ethylbenzene-1,3-diol;methoxymethane |
| SMILES | CCc1ccc(O)cc1O.COC |
| InChI | InChI=1S/C8H10O2.C2H6O/c1-2-6-3-4-7(9)5-8(6)10;1-3-2/h3-5,9-10H,2H2,1H3;1-2H3 |
| InChIKey | UJJSXLWLXLNXHF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |