C9H10O4 — CID 102447193
(2,4-dihydroxyphenyl)methyl acetate (PubChem CID 102447193) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is (2,4-dihydroxyphenyl)methyl acetate.
| Compound Name | (2,4-dihydroxyphenyl)methyl acetate |
|---|---|
| PubChem CID | 102447193 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (2,4-dihydroxyphenyl)methyl acetate |
| SMILES | CC(=O)OCc1ccc(O)cc1O |
| InChI | InChI=1S/C9H10O4/c1-6(10)13-5-7-2-3-8(11)4-9(7)12/h2-4,11-12H,5H2,1H3 |
| InChIKey | SQXHALHKLSLQIX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |