C9H13FO2 — CID 172565118
ethane;4-(fluoromethyl)benzene-1,3-diol (PubChem CID 172565118) has the molecular formula C9H13FO2 and a molecular weight of 172.20 g/mol. Its IUPAC name is ethane;4-(fluoromethyl)benzene-1,3-diol.
| Compound Name | ethane;4-(fluoromethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 172565118 |
| Molecular Formula | C9H13FO2 |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | ethane;4-(fluoromethyl)benzene-1,3-diol |
| SMILES | CC.Oc1ccc(CF)c(O)c1 |
| InChI | InChI=1S/C7H7FO2.C2H6/c8-4-5-1-2-6(9)3-7(5)10;1-2/h1-3,9-10H,4H2;1-2H3 |
| InChIKey | WITOWPQRXVLWPL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |