C13H11FO2 — CID 164899043
4-[(4-fluorophenyl)methyl]benzene-1,3-diol (PubChem CID 164899043) has the molecular formula C13H11FO2 and a molecular weight of 218.23 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]benzene-1,3-diol.
| Compound Name | 4-[(4-fluorophenyl)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 164899043 |
| Molecular Formula | C13H11FO2 |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(Cc2ccc(F)cc2)c(O)c1 |
| InChI | InChI=1S/C13H11FO2/c14-11-4-1-9(2-5-11)7-10-3-6-12(15)8-13(10)16/h1-6,8,15-16H,7H2 |
| InChIKey | ZKZHPFSBDSXZLC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |