C11H11NO4 — CID 123591745
3-[(2,4-dihydroxyphenyl)methyl]-1H-pyrrole-2,5-diol (PubChem CID 123591745) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-[(2,4-dihydroxyphenyl)methyl]-1H-pyrrole-2,5-diol.
| Compound Name | 3-[(2,4-dihydroxyphenyl)methyl]-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123591745 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-[(2,4-dihydroxyphenyl)methyl]-1H-pyrrole-2,5-diol |
| SMILES | Oc1ccc(Cc2cc(O)[nH]c2O)c(O)c1 |
| InChI | InChI=1S/C11H11NO4/c13-8-2-1-6(9(14)5-8)3-7-4-10(15)12-11(7)16/h1-2,4-5,12-16H,3H2 |
| InChIKey | TWIBJTYYKRUJJR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |