C13H12O4 — CID 86005366
2-[(2,4-dihydroxyphenyl)methyl]benzene-1,3-diol (PubChem CID 86005366) has the molecular formula C13H12O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[(2,4-dihydroxyphenyl)methyl]benzene-1,3-diol.
| Compound Name | 2-[(2,4-dihydroxyphenyl)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 86005366 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[(2,4-dihydroxyphenyl)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(Cc2c(O)cccc2O)c(O)c1 |
| InChI | InChI=1S/C13H12O4/c14-9-5-4-8(13(17)7-9)6-10-11(15)2-1-3-12(10)16/h1-5,7,14-17H,6H2 |
| InChIKey | QXVBXKXBPZYNDW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |