C14H16O3 — CID 174818892
4-(2-phenylethyl)benzene-1,3-diol;hydrate (PubChem CID 174818892) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-(2-phenylethyl)benzene-1,3-diol;hydrate.
| Compound Name | 4-(2-phenylethyl)benzene-1,3-diol;hydrate |
|---|---|
| PubChem CID | 174818892 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 4-(2-phenylethyl)benzene-1,3-diol;hydrate |
| SMILES | O.Oc1ccc(CCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C14H14O2.H2O/c15-13-9-8-12(14(16)10-13)7-6-11-4-2-1-3-5-11;/h1-5,8-10,15-16H,6-7H2;1H2 |
| InChIKey | JZNPPLBDBDJTNW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |