About 2-(2-phenylethyl)phenol;hydrate
2-(2-phenylethyl)phenol;hydrate (PubChem CID 157150935) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(2-phenylethyl)phenol;hydrate.
Molecular Properties
| Compound Name | 2-(2-phenylethyl)phenol;hydrate |
| PubChem CID | 157150935 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-(2-phenylethyl)phenol;hydrate |
| SMILES | O.Oc1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C14H14O.H2O/c15-14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12;/h1-9,15H,10-11H2;1H2 |
| InChIKey | FGXXMVLRUMBJBX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-phenylethyl)phenol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethyl)phenol;hydrate?
The IUPAC name of 2-(2-phenylethyl)phenol;hydrate (CID 157150935) is 2-(2-phenylethyl)phenol;hydrate.
What is the SMILES notation for 2-(2-phenylethyl)phenol;hydrate?
The canonical SMILES for 2-(2-phenylethyl)phenol;hydrate is O.Oc1ccccc1CCc1ccccc1.
What is the InChIKey of 2-(2-phenylethyl)phenol;hydrate?
The InChIKey is FGXXMVLRUMBJBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.H2O/c15-14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12;/h1-9,15H,10-11H2;1H2.
What are the key properties of 2-(2-phenylethyl)phenol;hydrate?
2-(2-phenylethyl)phenol;hydrate has a molecular weight of 216.28 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethyl)phenol;hydrate is sourced from PubChem (CID 157150935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).