About 2-benzylphenol;ethane
2-benzylphenol;ethane (PubChem CID 91068983) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-benzylphenol;ethane.
Molecular Properties
| Compound Name | 2-benzylphenol;ethane |
| PubChem CID | 91068983 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-benzylphenol;ethane |
| SMILES | CC.CC.Oc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C13H12O.2C2H6/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;2*1-2/h1-9,14H,10H2;2*1-2H3 |
| InChIKey | FGBRLJUMGCGIEZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzylphenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylphenol;ethane?
The IUPAC name of 2-benzylphenol;ethane (CID 91068983) is 2-benzylphenol;ethane.
What is the SMILES notation for 2-benzylphenol;ethane?
The canonical SMILES for 2-benzylphenol;ethane is CC.CC.Oc1ccccc1Cc1ccccc1.
What is the InChIKey of 2-benzylphenol;ethane?
The InChIKey is FGBRLJUMGCGIEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.2C2H6/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;2*1-2/h1-9,14H,10H2;2*1-2H3.
What are the key properties of 2-benzylphenol;ethane?
2-benzylphenol;ethane has a molecular weight of 244.38 g/mol, XLogP of 5.04, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylphenol;ethane is sourced from PubChem (CID 91068983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).