About 1-benzyl-2-methylbenzene;hydrochloride
1-benzyl-2-methylbenzene;hydrochloride (PubChem CID 139328614) has the molecular formula C14H15Cl
and a molecular weight of 218.73 g/mol. Its IUPAC name is 1-benzyl-2-methylbenzene;hydrochloride.
Molecular Properties
| Compound Name | 1-benzyl-2-methylbenzene;hydrochloride |
| PubChem CID | 139328614 |
| Molecular Formula | C14H15Cl |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-benzyl-2-methylbenzene;hydrochloride |
| SMILES | Cc1ccccc1Cc1ccccc1.Cl |
| InChI | InChI=1S/C14H14.ClH/c1-12-7-5-6-10-14(12)11-13-8-3-2-4-9-13;/h2-10H,11H2,1H3;1H |
| InChIKey | YXVFCRKYOAFHEX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-benzyl-2-methylbenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-methylbenzene;hydrochloride?
The IUPAC name of 1-benzyl-2-methylbenzene;hydrochloride (CID 139328614) is 1-benzyl-2-methylbenzene;hydrochloride.
What is the SMILES notation for 1-benzyl-2-methylbenzene;hydrochloride?
The canonical SMILES for 1-benzyl-2-methylbenzene;hydrochloride is Cc1ccccc1Cc1ccccc1.Cl.
What is the InChIKey of 1-benzyl-2-methylbenzene;hydrochloride?
The InChIKey is YXVFCRKYOAFHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.ClH/c1-12-7-5-6-10-14(12)11-13-8-3-2-4-9-13;/h2-10H,11H2,1H3;1H.
What are the key properties of 1-benzyl-2-methylbenzene;hydrochloride?
1-benzyl-2-methylbenzene;hydrochloride has a molecular weight of 218.73 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-methylbenzene;hydrochloride is sourced from PubChem (CID 139328614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).