C15H15Cl — CID 141001175
1-benzyl-2-chloro-3,4-dimethylbenzene (PubChem CID 141001175) has the molecular formula C15H15Cl and a molecular weight of 230.74 g/mol. Its IUPAC name is 1-benzyl-2-chloro-3,4-dimethylbenzene.
| Compound Name | 1-benzyl-2-chloro-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 141001175 |
| Molecular Formula | C15H15Cl |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-benzyl-2-chloro-3,4-dimethylbenzene |
| SMILES | Cc1ccc(Cc2ccccc2)c(Cl)c1C |
| InChI | InChI=1S/C15H15Cl/c1-11-8-9-14(15(16)12(11)2)10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | VBIDYGHMXFMMBY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |