C13H10Cl2O — CID 141169033
4-benzyl-2,3-dichlorophenol (PubChem CID 141169033) has the molecular formula C13H10Cl2O and a molecular weight of 253.13 g/mol. Its IUPAC name is 4-benzyl-2,3-dichlorophenol.
| Compound Name | 4-benzyl-2,3-dichlorophenol |
|---|---|
| PubChem CID | 141169033 |
| Molecular Formula | C13H10Cl2O |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 4-benzyl-2,3-dichlorophenol |
| SMILES | Oc1ccc(Cc2ccccc2)c(Cl)c1Cl |
| InChI | InChI=1S/C13H10Cl2O/c14-12-10(6-7-11(16)13(12)15)8-9-4-2-1-3-5-9/h1-7,16H,8H2 |
| InChIKey | WJOUVHSDQPSTRH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |