C25H24O4 — CID 159915102
bis(benzene-1,4-diol);benzylbenzene (PubChem CID 159915102) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is bis(benzene-1,4-diol);benzylbenzene.
| Compound Name | bis(benzene-1,4-diol);benzylbenzene |
|---|---|
| PubChem CID | 159915102 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | bis(benzene-1,4-diol);benzylbenzene |
| SMILES | Oc1ccc(O)cc1.Oc1ccc(O)cc1.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.2C6H6O2/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*7-5-1-2-6(8)4-3-5/h1-10H,11H2;2*1-4,7-8H |
| InChIKey | NXRFLJCULPDZHZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|