About benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol
benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol (PubChem CID 159586840) has the molecular formula C31H26O2
and a molecular weight of 430.55 g/mol. Its IUPAC name is benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol.
Molecular Properties
| Compound Name | benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol |
| PubChem CID | 159586840 |
| Molecular Formula | C31H26O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol |
| SMILES | Oc1ccccc1-c1ccccc1-c1ccccc1O.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H14O2.C13H12/c19-17-11-5-3-9-15(17)13-7-1-2-8-14(13)16-10-4-6-12-18(16)20;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-12,19-20H;1-10H,11H2 |
| InChIKey | MJSLNZPCHRZKOI-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol?
The IUPAC name of benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol (CID 159586840) is benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol.
What is the SMILES notation for benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol?
The canonical SMILES for benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol is Oc1ccccc1-c1ccccc1-c1ccccc1O.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol?
The InChIKey is MJSLNZPCHRZKOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O2.C13H12/c19-17-11-5-3-9-15(17)13-7-1-2-8-14(13)16-10-4-6-12-18(16)20;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-12,19-20H;1-10H,11H2.
What are the key properties of benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol?
benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol has a molecular weight of 430.55 g/mol, XLogP of 7.71, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;2-[2-(2-hydroxyphenyl)phenyl]phenol is sourced from PubChem (CID 159586840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).