About potassium;benzylbenzene;hydride
potassium;benzylbenzene;hydride (PubChem CID 173011788) has the molecular formula C13H13K
and a molecular weight of 208.35 g/mol. Its IUPAC name is potassium;benzylbenzene;hydride.
Molecular Properties
| Compound Name | potassium;benzylbenzene;hydride |
| PubChem CID | 173011788 |
| Molecular Formula | C13H13K |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | potassium;benzylbenzene;hydride |
| SMILES | [H-].[K+].c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.K.H/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;/h1-10H,11H2;;/q;+1;-1 |
| InChIKey | RMIAZSBPCOCSLK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze potassium;benzylbenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;benzylbenzene;hydride?
The IUPAC name of potassium;benzylbenzene;hydride (CID 173011788) is potassium;benzylbenzene;hydride.
What is the SMILES notation for potassium;benzylbenzene;hydride?
The canonical SMILES for potassium;benzylbenzene;hydride is [H-].[K+].c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of potassium;benzylbenzene;hydride?
The InChIKey is RMIAZSBPCOCSLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.K.H/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;/h1-10H,11H2;;/q;+1;-1.
What are the key properties of potassium;benzylbenzene;hydride?
potassium;benzylbenzene;hydride has a molecular weight of 208.35 g/mol, XLogP of 0.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;benzylbenzene;hydride is sourced from PubChem (CID 173011788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).