About benzylbenzene;ethane;methoxymethane
benzylbenzene;ethane;methoxymethane (PubChem CID 159187560) has the molecular formula C25H48O2
and a molecular weight of 380.66 g/mol. Its IUPAC name is benzylbenzene;ethane;methoxymethane.
Molecular Properties
| Compound Name | benzylbenzene;ethane;methoxymethane |
| PubChem CID | 159187560 |
| Molecular Formula | C25H48O2 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.37 |
| IUPAC Name | benzylbenzene;ethane;methoxymethane |
| SMILES | CC.CC.CC.CC.COC.COC.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.2C2H6O.4C2H6/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*1-3-2;4*1-2/h1-10H,11H2;2*1-2H3;4*1-2H3 |
| InChIKey | KNRJROWEWPULNJ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzylbenzene;ethane;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;ethane;methoxymethane?
The IUPAC name of benzylbenzene;ethane;methoxymethane (CID 159187560) is benzylbenzene;ethane;methoxymethane.
What is the SMILES notation for benzylbenzene;ethane;methoxymethane?
The canonical SMILES for benzylbenzene;ethane;methoxymethane is CC.CC.CC.CC.COC.COC.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;ethane;methoxymethane?
The InChIKey is KNRJROWEWPULNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.2C2H6O.4C2H6/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*1-3-2;4*1-2/h1-10H,11H2;2*1-2H3;4*1-2H3.
What are the key properties of benzylbenzene;ethane;methoxymethane?
benzylbenzene;ethane;methoxymethane has a molecular weight of 380.66 g/mol, XLogP of 7.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;ethane;methoxymethane is sourced from PubChem (CID 159187560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).