About benzylbenzene;methoxymethane
benzylbenzene;methoxymethane (PubChem CID 161110966) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is benzylbenzene;methoxymethane.
Molecular Properties
| Compound Name | benzylbenzene;methoxymethane |
| PubChem CID | 161110966 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | benzylbenzene;methoxymethane |
| SMILES | COC.COC.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.2C2H6O/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*1-3-2/h1-10H,11H2;2*1-2H3 |
| InChIKey | UJRKHCGVSVHASP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzylbenzene;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;methoxymethane?
The IUPAC name of benzylbenzene;methoxymethane (CID 161110966) is benzylbenzene;methoxymethane.
What is the SMILES notation for benzylbenzene;methoxymethane?
The canonical SMILES for benzylbenzene;methoxymethane is COC.COC.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;methoxymethane?
The InChIKey is UJRKHCGVSVHASP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.2C2H6O/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*1-3-2/h1-10H,11H2;2*1-2H3.
What are the key properties of benzylbenzene;methoxymethane?
benzylbenzene;methoxymethane has a molecular weight of 260.38 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;methoxymethane is sourced from PubChem (CID 161110966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).