C21H28Cl2N2O — CID 142098913
4-[[benzyl-[3-(diethylamino)propyl]amino]methyl]-2,3-dichlorophenol (PubChem CID 142098913) has the molecular formula C21H28Cl2N2O and a molecular weight of 395.37 g/mol. Its IUPAC name is 4-[[benzyl-[3-(diethylamino)propyl]amino]methyl]-2,3-dichlorophenol.
| Compound Name | 4-[[benzyl-[3-(diethylamino)propyl]amino]methyl]-2,3-dichlorophenol |
|---|---|
| PubChem CID | 142098913 |
| Molecular Formula | C21H28Cl2N2O |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-[[benzyl-[3-(diethylamino)propyl]amino]methyl]-2,3-dichlorophenol |
| SMILES | CCN(CC)CCCN(Cc1ccccc1)Cc1ccc(O)c(Cl)c1Cl |
| InChI | InChI=1S/C21H28Cl2N2O/c1-3-24(4-2)13-8-14-25(15-17-9-6-5-7-10-17)16-18-11-12-19(26)21(23)20(18)22/h5-7,9-12,26H,3-4,8,13-16H2,1-2H3 |
| InChIKey | AFRSACQFUFUVMK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |