C13H23NO — CID 172794416
N,N-diethyl-3-phenylpropan-1-amine;hydrate (PubChem CID 172794416) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N,N-diethyl-3-phenylpropan-1-amine;hydrate.
| Compound Name | N,N-diethyl-3-phenylpropan-1-amine;hydrate |
|---|---|
| PubChem CID | 172794416 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N,N-diethyl-3-phenylpropan-1-amine;hydrate |
| SMILES | CCN(CC)CCCc1ccccc1.O |
| InChI | InChI=1S/C13H21N.H2O/c1-3-14(4-2)12-8-11-13-9-6-5-7-10-13;/h5-7,9-10H,3-4,8,11-12H2,1-2H3;1H2 |
| InChIKey | PZUXQVRPEFWQEB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |