C15H22N2 — CID 61225285
3-[ethyl(3-phenylpropyl)amino]-2-methylpropanenitrile (PubChem CID 61225285) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 3-[ethyl(3-phenylpropyl)amino]-2-methylpropanenitrile.
| Compound Name | 3-[ethyl(3-phenylpropyl)amino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 61225285 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-[ethyl(3-phenylpropyl)amino]-2-methylpropanenitrile |
| SMILES | CCN(CCCc1ccccc1)CC(C)C#N |
| InChI | InChI=1S/C15H22N2/c1-3-17(13-14(2)12-16)11-7-10-15-8-5-4-6-9-15/h4-6,8-9,14H,3,7,10-11,13H2,1-2H3 |
| InChIKey | LLTZUKXTHBAFQF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |