C14H24N2 — CID 43137195
N'-ethyl-N'-(3-phenylpropyl)propane-1,3-diamine (PubChem CID 43137195) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N'-ethyl-N'-(3-phenylpropyl)propane-1,3-diamine.
| Compound Name | N'-ethyl-N'-(3-phenylpropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 43137195 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N'-ethyl-N'-(3-phenylpropyl)propane-1,3-diamine |
| SMILES | CCN(CCCN)CCCc1ccccc1 |
| InChI | InChI=1S/C14H24N2/c1-2-16(13-7-11-15)12-6-10-14-8-4-3-5-9-14/h3-5,8-9H,2,6-7,10-13,15H2,1H3 |
| InChIKey | NLIGGOKSDGVBFI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |