C22H41NO — CID 173447962
N,N-diethyl-12-phenyldodecan-1-amine;hydrate (PubChem CID 173447962) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is N,N-diethyl-12-phenyldodecan-1-amine;hydrate.
| Compound Name | N,N-diethyl-12-phenyldodecan-1-amine;hydrate |
|---|---|
| PubChem CID | 173447962 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | N,N-diethyl-12-phenyldodecan-1-amine;hydrate |
| SMILES | CCN(CC)CCCCCCCCCCCCc1ccccc1.O |
| InChI | InChI=1S/C22H39N.H2O/c1-3-23(4-2)21-17-12-10-8-6-5-7-9-11-14-18-22-19-15-13-16-20-22;/h13,15-16,19-20H,3-12,14,17-18,21H2,1-2H3;1H2 |
| InChIKey | KPYSUJGUEZIRMZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|