C13H25IN2 — CID 175520694
azane;N,N-diethyl-3-phenylpropan-1-amine;hydroiodide (PubChem CID 175520694) has the molecular formula C13H25IN2 and a molecular weight of 336.26 g/mol. Its IUPAC name is azane;N,N-diethyl-3-phenylpropan-1-amine;hydroiodide.
| Compound Name | azane;N,N-diethyl-3-phenylpropan-1-amine;hydroiodide |
|---|---|
| PubChem CID | 175520694 |
| Molecular Formula | C13H25IN2 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | azane;N,N-diethyl-3-phenylpropan-1-amine;hydroiodide |
| SMILES | CCN(CC)CCCc1ccccc1.I.N |
| InChI | InChI=1S/C13H21N.HI.H3N/c1-3-14(4-2)12-8-11-13-9-6-5-7-10-13;;/h5-7,9-10H,3-4,8,11-12H2,1-2H3;1H;1H3 |
| InChIKey | JHHOCKXCYBCMII-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|